Difference between revisions of "RXN-15733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/2.7.6.3 EC-2.7.6.3] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[CPD-16953]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-16954]][c] '''+''' 1 [[AMP]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c] '''+''' 1 AMP[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00007059001_1]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | * Gene: [[CHC_T00003007001_1]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6148]], tetrahydromethanopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6148 PWY-6148] | ||
| + | ** '''2''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.7.6.3}} | |
| − | + | {{#set: gene associated=CHC_T00007059001_1|CHC_T00003007001_1}} | |
| − | + | {{#set: in pathway=PWY-6148}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 14:58, 23 May 2018
Contents
Reaction RXN-15733
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] + 1 ATP[c] => 1 H+[c] + 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00007059001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00003007001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6148, tetrahydromethanopterin biosynthesis: PWY-6148
- 2 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
