Difference between revisions of "KDO2-LIPID-IVA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLYL_MANDELATE VANILLYL_MANDELATE] == * smiles: ** COC1(C(O)=CC=C(C=1)C(O)C(=O)[O-]) * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO2-LIPID-IVA KDO2-LIPID-IVA] == * smiles: ** CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO2-LIPID-IVA KDO2-LIPID-IVA] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C(O)C(OC(CC(O)CCCCCCCCCCC)=O)1)COC2(C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(C(O2)COC4(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C3))C4))OP([O-])([O-])=O)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XAOLJGCZESYRFT-RAINXGQXSA-H |
* common name: | * common name: | ||
− | ** | + | ** α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1840.032 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (Kdo)2-lipid IVA |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[KDOTRANS2-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820576 91820576] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60365 60365] |
− | * | + | * BIGG : kdo2lipid4 |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06025 C06025] |
− | {{#set: common name= | + | {{#set: smiles=CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C(O)C(OC(CC(O)CCCCCCCCCCC)=O)1)COC2(C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(C(O2)COC4(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C3))C4))OP([O-])([O-])=O))}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XAOLJGCZESYRFT-RAINXGQXSA-H}} |
− | {{#set: common name= | + | {{#set: common name=α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA}} |
− | {{#set: produced by= | + | {{#set: molecular weight=1840.032 }} |
+ | {{#set: common name=(Kdo)2-lipid IVA}} | ||
+ | {{#set: produced by=KDOTRANS2-RXN}} |
Revision as of 16:07, 23 May 2018
Contents
Metabolite KDO2-LIPID-IVA
- smiles:
- CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C(O)C(OC(CC(O)CCCCCCCCCCC)=O)1)COC2(C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(C(O2)COC4(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C3))C4))OP([O-])([O-])=O))
- inchi key:
- InChIKey=XAOLJGCZESYRFT-RAINXGQXSA-H
- common name:
- α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA
- molecular weight:
- 1840.032
- Synonym(s):
- (Kdo)2-lipid IVA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O-])([O-])=O)OC(C(O)C(OC(CC(O)CCCCCCCCCCC)=O)1)COC2(C(NC(CC(O)CCCCCCCCCCC)=O)C(OC(CC(O)CCCCCCCCCCC)=O)C(C(O2)COC4(C([O-])=O)(O[CH](C(CO)O)C(O)C(OC3(C([O-])=O)(O[CH](C(CO)O)C(O)C(O)C3))C4))OP([O-])([O-])=O))" cannot be used as a page name in this wiki.
"α-Kdo-(2->4)-α-Kdo-(2->6)-lipid IVA" cannot be used as a page name in this wiki.