Difference between revisions of "CHC T00002063001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
(Created page with "Category:Gene == Gene CHC_T00002063001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-11109 ** Source: orthology-galdieria.sulphuraria == Pathways...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Gene CHC_T00002063001_1 ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
* common name:
+
** 4α-methyl-5α-cholesta-8-en-3-one
+
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11109]]
* [[RXN66-18]]
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-11109}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
+
* HMDB : HMDB12174
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN66-18}}
+

Latest revision as of 16:17, 23 May 2018

Gene CHC_T00002063001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links