Difference between revisions of "LIPAS-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
− | ** | + | ** triacylglycerol degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** triacylglyceride degradation |
− | ** | + | ** triacylglycerol hydrolysis |
− | ** | + | ** lipolysis |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''4''' reactions in the full pathway |
− | * [[ | + | * [[3.1.1.23-RXN]] |
− | + | ** 1 associated gene(s): | |
− | == Reaction(s) | + | *** [[CHC_T00001533001_1]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
+ | ** 8 associated gene(s): | ||
+ | *** [[CHC_T00002434001_1]] | ||
+ | *** [[CHC_T00009452001_1]] | ||
+ | *** [[CHC_T00009491001_1]] | ||
+ | *** [[CHC_T00000198001_1]] | ||
+ | *** [[CHC_T00000853001_1]] | ||
+ | *** [[CHC_T00005737001_1]] | ||
+ | *** [[CHC_T00000197001_1]] | ||
+ | *** [[CHC_T00008615001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1602 RXN-1602] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1603 RXN-1603] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=LIPAS-PWY LIPAS-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2759}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=triacylglycerol degradation}} | |
− | + | {{#set: common name=triacylglyceride degradation|triacylglycerol hydrolysis|lipolysis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:22, 23 May 2018
Pathway LIPAS-PWY
- taxonomic range:
- common name:
- triacylglycerol degradation
- Synonym(s):
- triacylglyceride degradation
- triacylglycerol hydrolysis
- lipolysis
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- 3.1.1.23-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- TRIACYLGLYCEROL-LIPASE-RXN
- 8 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: