Difference between revisions of "RXN-17781"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17781 RXN-17781] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-19168]][c] '''=>''' 1 [[CPD-19167]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] '''=>''' 1 3-oxo-(7Z)-hexadecenoyl-CoA[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[CHC_T00009349001_1]] |
| − | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
| + | * Gene: [[CHC_T00009422001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | * Gene: [[CHC_T00008557001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.1.1.35}} | |
| − | + | {{#set: gene associated=CHC_T00009349001_1|CHC_T00009422001_1|CHC_T00008557001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:27, 23 May 2018
Contents
Reaction RXN-17781
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA[c] => 1 3-oxo-(7Z)-hexadecenoyl-CoA[c] + 1 NADH[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009349001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009422001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008557001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
