Difference between revisions of "CHC T00010194001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00010194001 == * left end position: ** 106245 * transcription direction: ** NEGATIVE * right end position: ** 106568 * centisome position: ** 68...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00010194001 == |
− | * | + | * left end position: |
− | ** | + | ** 106245 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 106568 |
− | * | + | * centisome position: |
− | ** | + | ** 68.18576 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPSYN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=106245}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=106568}} | |
− | + | {{#set: centisome position=68.18576 }} | |
− | + | {{#set: reaction associated=ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:31, 23 May 2018
Gene CHC_T00010194001
- left end position:
- 106245
- transcription direction:
- NEGATIVE
- right end position:
- 106568
- centisome position:
- 68.18576
- Synonym(s):
Reactions associated
- Reaction: ATPSYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome