Difference between revisions of "CPD-18780"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDPDIACYLGLYCEROL CDPDIACYLGLYCEROL] == * common name: ** a CDP-diacylglycerol * Synonym(s): **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == * smiles: ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) * inchi key: ** InChIKey=JC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] == |
+ | * smiles: | ||
+ | ** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2-epi-valiolone |
+ | * molecular weight: | ||
+ | ** 192.168 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17373]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N}} |
− | {{#set: | + | {{#set: common name=2-epi-valiolone}} |
− | {{#set: produced by= | + | {{#set: molecular weight=192.168 }} |
+ | {{#set: common name=(2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}} | ||
+ | {{#set: produced by=RXN-17373}} |
Revision as of 15:35, 23 May 2018
Contents
Metabolite CPD-18780
- smiles:
- C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
- inchi key:
- InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N
- common name:
- 2-epi-valiolone
- molecular weight:
- 192.168
- Synonym(s):
- (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one