Difference between revisions of "HEXADECANOL-DEHYDROGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (R)-demethy...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEXADECANOL-DEHYDROGENASE-RXN HEXADECANOL-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * ec num...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEXADECANOL-DEHYDROGENASE-RXN HEXADECANOL-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.164 EC-1.1.1.164] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-348]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[PALMITALDEHYDE]][c] '''+''' 1 [[NADH]][c] | |
− | * [ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 1-hexadecanol[c] '''<=>''' 1 H+[c] '''+''' 1 palmitaldehyde[c] '''+''' 1 NADH[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | + | * RHEA: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22056 22056] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02462 R02462] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.164}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=gap-filling}} |
+ | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | ||
+ | {{#set: reconstruction tool=meneco}} | ||
+ | {{#set: reconstruction comment=added for gapfilling}} |
Latest revision as of 16:44, 23 May 2018
Contents
Reaction HEXADECANOL-DEHYDROGENASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 CPD-348[c] <=> 1 PROTON[c] + 1 PALMITALDEHYDE[c] + 1 NADH[c]
- With common name(s):
- 1 NAD+[c] + 1 1-hexadecanol[c] <=> 1 H+[c] + 1 palmitaldehyde[c] + 1 NADH[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
External links