Difference between revisions of "CPD0-2350"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] == * smiles: ** C=CC2(C(C)=C4(C=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2350 CPD0-2350] == * common name: ** a polycistronic tRNA precursor * Synonym(s): == Reac...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROXY-MAGNESIUM-PROTOPORP 13-HYDROXY-MAGNESIUM-PROTOPORP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2350 CPD0-2350] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))
+
 
* common name:
 
* common name:
** 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester
+
** a polycistronic tRNA precursor
* molecular weight:
+
** 613.974   
+
 
* Synonym(s):
 
* Synonym(s):
** 131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5283]]
+
* [[RXN0-6478]]
 +
* [[3.1.27.9-RXN]]
 +
* [[RXN0-6485]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5282]]
+
* [[RXN0-6478]]
 +
* [[RXN0-6485]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a polycistronic tRNA precursor}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658233 90658233]
+
{{#set: consumed by=RXN0-6478|3.1.27.9-RXN|RXN0-6485}}
* CHEBI:
+
{{#set: produced by=RXN0-6478|RXN0-6485}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60489 60489]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11829 C11829]
+
* HMDB : HMDB02379
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(O)CC(=O)OC)C(N56)=C7))))8))))}}
+
{{#set: common name=131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: molecular weight=613.974    }}
+
{{#set: common name=131-hydroxy-Mg-protoporphyrin IX 13-monomethyl ester}}
+
{{#set: consumed by=RXN-5283}}
+
{{#set: produced by=RXN-5282}}
+

Revision as of 15:45, 23 May 2018

Metabolite CPD0-2350

  • common name:
    • a polycistronic tRNA precursor
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links