Difference between revisions of "CHC T00009102001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] == * smiles: ** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1) * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene CHC_T00009102001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN0-2381 ** Source: orthology-galdieria.sulphuraria ** Source: [...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13914 CPD-13914] ==
+
== Gene CHC_T00009102001_1 ==
−
* smiles:
+
−
** C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)
+
−
* inchi key:
+
−
** InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M
+
−
* common name:
+
−
** cyclic-2,3-O-oxalyl-L-threonate
+
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-cyclic oxalyl theronolactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12872]]
+
* Reaction: [[RXN0-2381]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
−
* [[RXN-12869]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN0-2382]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[TRYPSYN-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 +
* [[PWY-6949]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=RXN0-2381|RXN0-2382|TRYPSYN-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659383 90659383]
+
{{#set: pathway associated=TRPSYN-PWY|PWY-6949}}
−
{{#set: smiles=C(O)C1(OC(=O)C(=O)OC(C(=O)[O-])1)}}
+
−
{{#set: inchi key=InChIKey=NKBSFRFTBUHMJF-UHFFFAOYSA-M}}
+
−
{{#set: common name=cyclic-2,3-O-oxalyl-L-threonate}}
+
−
{{#set: molecular weight=189.101    }}
+
−
{{#set: common name=2,3-cyclic oxalyl theronolactone}}
+
−
{{#set: consumed by=RXN-12872}}
+
−
{{#set: produced by=RXN-12869}}
+

Latest revision as of 15:54, 23 May 2018

Gene CHC_T00009102001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009102001_1&oldid=15643"