Difference between revisions of "CPD-17370"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 18-hydroxyoleoyl-CoA |
+ | * molecular weight: | ||
+ | ** 1043.952 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** (9Z)-18-hydroxyoctadec-9-enoyl-CoA |
+ | ** ω-hydroxyoleoyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-16117]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[RXN- | + | * [[RXN-16402]] |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044] |
− | {{#set: common name=( | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}} |
− | {{#set: | + | {{#set: common name=18-hydroxyoleoyl-CoA}} |
− | + | {{#set: molecular weight=1043.952 }} | |
+ | {{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-16117}} | ||
+ | {{#set: produced by=RXN-16402}} |
Revision as of 15:55, 23 May 2018
Contents
Metabolite CPD-17370
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
- common name:
- 18-hydroxyoleoyl-CoA
- molecular weight:
- 1043.952
- Synonym(s):
- (9Z)-18-hydroxyoctadec-9-enoyl-CoA
- ω-hydroxyoleoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.