Difference between revisions of "CHC T00009338001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLEIC_ACID LINOLEIC_ACID] == * smiles: ** CCCCCC=CCC=CCCCCCCCC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene CHC_T00009338001 == * left end position: ** 45687 * transcription direction: ** POSITIVE * right end position: ** 46964 * centisome position: ** 19.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009338001 == |
− | * | + | * left end position: |
− | ** | + | ** 45687 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 46964 |
− | * | + | * centisome position: |
− | ** | + | ** 19.872812 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-17373]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=45687}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=46964}} | |
− | + | {{#set: centisome position=19.872812 }} | |
− | + | {{#set: reaction associated=RXN-17373}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 16:55, 23 May 2018
Gene CHC_T00009338001
- left end position:
- 45687
- transcription direction:
- POSITIVE
- right end position:
- 46964
- centisome position:
- 19.872812
- Synonym(s):
Reactions associated
- Reaction: RXN-17373
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome