Difference between revisions of "2.4.1.109-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.109-RXN 2.4.1.109-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.or...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.109-RXN 2.4.1.109-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.109 EC-2.4.1.109] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-171]][c] '''+''' 1 [[Protein-L-serine-or-L-threonine]][c] '''<=>''' 1 [[O-D-MANNOSYL-PROTEIN]][c] '''+''' 1 [[DOLICHOLP]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a dolichyl β-D-mannosyl phosphate[c] '''+''' 1 a [protein]-(L-serine/L-threonine)[c] '''<=>''' 1 a [protein]-O-D-mannosyl-(L-serine/L-threonine)[c] '''+''' 1 a dolichyl phosphate[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009268001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00010153001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/P33775 P33775] | |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P31382 P31382] |
− | + | ** [http://www.uniprot.org/uniprot/P47190 P47190] | |
− | + | ** [http://www.uniprot.org/uniprot/P46971 P46971] | |
− | ** [http://www. | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: ec number=EC-2.4.1.109}} | |
− | ** [http://www. | + | {{#set: gene associated=CHC_T00009268001_1|CHC_T00010153001_1}} |
− | + | {{#set: in pathway=}} | |
− | ** [http://www. | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:11, 23 May 2018
Contents
Reaction 2.4.1.109-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-171[c] + 1 Protein-L-serine-or-L-threonine[c] <=> 1 O-D-MANNOSYL-PROTEIN[c] + 1 DOLICHOLP[c] + 1 PROTON[c]
- With common name(s):
- 1 a dolichyl β-D-mannosyl phosphate[c] + 1 a [protein]-(L-serine/L-threonine)[c] <=> 1 a [protein]-O-D-mannosyl-(L-serine/L-threonine)[c] + 1 a dolichyl phosphate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009268001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00010153001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links