Difference between revisions of "CPD0-2244"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00002741001_1 == * Synonym(s): == Reactions associated == * MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN ** pantograph-galdieria.sulphurari...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00002741001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
 +
* smiles:
 +
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
 +
* molecular weight:
 +
** 933.753   
 +
* inchi key:
 +
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
 +
* common name:
 +
** (S)-3-hydroxydecanoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
+
* [[RXN-12490]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-13616]]
* [[PWY-7375]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-7375}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
 +
* BIGG : 3hdcoa
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
 +
* HMDB : HMDB03938
 +
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
 +
{{#set: molecular weight=933.753    }}
 +
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
 +
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
 +
{{#set: consumed by=RXN-12490}}
 +
{{#set: produced by=RXN-13616}}

Latest revision as of 14:58, 9 January 2019

Metabolite CPD0-2244

  • smiles:
    • CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • molecular weight:
    • 933.753
  • inchi key:
    • InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
  • common name:
    • (S)-3-hydroxydecanoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.