Difference between revisions of "PWY-6614"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614] ==
−
* smiles:
+
−
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
+
−
* inchi key:
+
−
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
+
 
* common name:
 
* common name:
−
** 1,2-dihydro-β-NADP
+
** tetrahydrofolate biosynthesis
−
* molecular weight:
+
* taxonomic range:
−
** 741.394   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
+
** folic acid biosynthesis
−
** 2DHNADP
+
** folate biosynthesis
 +
** THF biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
* [[RXN-16765]]
+
* [[DIHYDROFOLATEREDUCT-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00010030001_1]]
 +
*** [[CHC_T00008680001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000400001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[H2PTEROATESYNTH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00003007001_1]]
 +
*** [[CHC_T00007059001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92136136 92136136]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6614 PWY-6614]
−
* CHEBI:
+
{{#set: common name=tetrahydrofolate biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=88137 88137]
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
+
{{#set: taxonomic range=TAX-4751}}
−
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=1,2-dihydro-β-NADP}}
+
{{#set: common name=folic acid biosynthesis|folate biosynthesis|THF biosynthesis}}
−
{{#set: molecular weight=741.394    }}
+
{{#set: reaction found=3}}
−
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
+
{{#set: total reaction=3}}
−
{{#set: produced by=RXN-16765}}
+
{{#set: completion rate=100.0}}

Latest revision as of 15:02, 9 January 2019

Pathway PWY-6614

  • common name:
    • tetrahydrofolate biosynthesis
  • taxonomic range:
  • Synonym(s):
    • folic acid biosynthesis
    • folate biosynthesis
    • THF biosynthesis

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6614&oldid=19736"