Difference between revisions of "CPD-786"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7165 PWY-7165] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(CCC=CC(C([O-])=O)=O)([O-])=O |
| + | * molecular weight: | ||
| + | ** 170.121 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** (4Z)-2-oxohept-4-enedioate |
* Synonym(s): | * Synonym(s): | ||
| + | ** OHED | ||
| + | ** 2-oxo-hept-3-ene-1,7-dioate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[4.1.1.68-RXN]] | |
| − | == Reaction(s) | + | * [[RXN1K-87]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17205 17205] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543150 9543150] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03063 C03063] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573699.html 4573699] | ||
| + | {{#set: smiles=C(CCC=CC(C([O-])=O)=O)([O-])=O}} | ||
| + | {{#set: molecular weight=170.121 }} | ||
| + | {{#set: inchi key=InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L}} | ||
| + | {{#set: common name=(4Z)-2-oxohept-4-enedioate}} | ||
| + | {{#set: common name=OHED|2-oxo-hept-3-ene-1,7-dioate}} | ||
| + | {{#set: produced by=4.1.1.68-RXN|RXN1K-87}} | ||
Latest revision as of 15:03, 9 January 2019
Contents
Metabolite CPD-786
- smiles:
- C(CCC=CC(C([O-])=O)=O)([O-])=O
- molecular weight:
- 170.121
- inchi key:
- InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L
- common name:
- (4Z)-2-oxohept-4-enedioate
- Synonym(s):
- OHED
- 2-oxo-hept-3-ene-1,7-dioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC=CC(C([O-])=O)=O)([O-])=O" cannot be used as a page name in this wiki.
