Difference between revisions of "CPD-7953"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005574001_1 == * Synonym(s): == Reactions associated == * MANNPISOM-RXN ** pantograph-galdieria.sulphuraria ** pantograph-a...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == |
+ | * smiles: | ||
+ | ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C | ||
+ | * molecular weight: | ||
+ | ** 534.867 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N | ||
+ | * common name: | ||
+ | ** torulene | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3',4'-didehydro-β,ψ-carotene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11989]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678] | ||
+ | {{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}} | ||
+ | {{#set: molecular weight=534.867 }} | ||
+ | {{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}} | ||
+ | {{#set: common name=torulene}} | ||
+ | {{#set: common name=3',4'-didehydro-β,ψ-carotene}} | ||
+ | {{#set: consumed by=RXN-11989}} |
Latest revision as of 16:08, 9 January 2019
Contents
Metabolite CPD-7953
- smiles:
- CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
- molecular weight:
- 534.867
- inchi key:
- InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
- common name:
- torulene
- Synonym(s):
- 3',4'-didehydro-β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links