Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TA...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* molecular weight:
 +
** 251.109   
 +
* inchi key:
 +
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
 
* common name:
 
* common name:
** superoxide radicals degradation
+
** shikimate 3-phosphate
 
* Synonym(s):
 
* Synonym(s):
** removal of superoxide radicals
+
** shikimate 5-phosphate
 +
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[CATAL-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[SUPEROX-DISMUT-RXN]]
+
* [[SHIKIMATE-KINASE-RXN]]
== Reaction(s) not found ==
+
* [[2.5.1.19-RXN]]
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* CHEBI:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
* ARACYC:
+
* BIGG : skm5p
** [http://metacyc.org/ARA/NEW-IMAGE?object=DETOX1-PWY DETOX1-PWY]
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2759}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
{{#set: taxonomic range=TAX-2}}
+
* LIGAND-CPD:
{{#set: common name=superoxide radicals degradation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
{{#set: common name=removal of superoxide radicals}}
+
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
{{#set: reaction found=2}}
+
{{#set: molecular weight=251.109    }}
{{#set: reaction not found=0}}
+
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
 +
{{#set: common name=shikimate 3-phosphate}}
 +
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
 +
{{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN|2.5.1.19-RXN}}

Latest revision as of 15:11, 9 January 2019

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • molecular weight:
    • 251.109
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • common name:
    • shikimate 3-phosphate
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.