Difference between revisions of "SHIKIMATE-5P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-482 RXN66-482] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-2-enoyl-CoA reductase...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) |
+ | * molecular weight: | ||
+ | ** 251.109 | ||
+ | * inchi key: | ||
+ | ** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** shikimate 3-phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** shikimate 5-phosphate | ||
+ | ** shikimate-5-P | ||
+ | ** 3-phosphoshikimate | ||
+ | ** shikimate-3-P | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[SHIKIMATE-KINASE-RXN]] | |
− | + | * [[2.5.1.19-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989] | |
− | + | * BIGG : skm5p | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806] | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}} |
− | {{#set: | + | {{#set: molecular weight=251.109 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}} |
− | {{#set: | + | {{#set: common name=shikimate 3-phosphate}} |
+ | {{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}} | ||
+ | {{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN|2.5.1.19-RXN}} |
Latest revision as of 15:11, 9 January 2019
Contents
Metabolite SHIKIMATE-5P
- smiles:
- C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
- molecular weight:
- 251.109
- inchi key:
- InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
- common name:
- shikimate 3-phosphate
- Synonym(s):
- shikimate 5-phosphate
- shikimate-5-P
- 3-phosphoshikimate
- shikimate-3-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.