Difference between revisions of "RXN-14025"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14025 RXN-14025] ==
−
* smiles:
+
* direction:
−
** C(CC(=O)C(=O)[O-])CC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L
+
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
−
* common name:
+
−
** 2-oxoadipate
+
−
* molecular weight:
+
−
** 158.11   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-ketoadipate
 
−
** α-ketoadipate
 
−
** 2-keto-adipate
 
−
** 2-oxohexanedionic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[UMP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[URIDINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 UMP[c] '''=>''' 1 phosphate[c] '''+''' 1 uridine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008300001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000267001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-7821]], tunicamycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7821 PWY-7821]
 +
** '''2''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7185]], UTP and CTP dephosphorylation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3184-35-8
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29360 29360]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615192 23615192]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB00225
+
{{#set: ec number=EC-3.1.3.5}}
−
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00008300001_1|CHC_T00000267001_1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00322 C00322]
+
{{#set: in pathway=PWY-7821|PWY-7185}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.19951093.html 19951093]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57499 57499]
+
−
* METABOLIGHTS : MTBLC57499
+
−
{{#set: smiles=C(CC(=O)C(=O)[O-])CC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FGSBNBBHOZHUBO-UHFFFAOYSA-L}}
+
−
{{#set: common name=2-oxoadipate}}
+
−
{{#set: molecular weight=158.11    }}
+
−
{{#set: common name=2-ketoadipate|α-ketoadipate|2-keto-adipate|2-oxohexanedionic acid}}
+
−
{{#set: consumed by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+

Latest revision as of 15:14, 9 January 2019

Reaction RXN-14025

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 UMP[c] => 1 phosphate[c] + 1 uridine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7821, tunicamycin biosynthesis: PWY-7821
    • 2 reactions found over 9 reactions in the full pathway
  • PWY-7185, UTP and CTP dephosphorylation I: PWY-7185
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-14025&oldid=20018"