Difference between revisions of "CPD-11938"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008383001 == * left end position: ** 158308 * transcription direction: ** POSITIVE * right end position: ** 159366 * centisome position: ** 81...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008383001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11938 CPD-11938] ==
* left end position:
+
* smiles:
** 158308
+
** C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)
* transcription direction:
+
* molecular weight:
** POSITIVE
+
** 805.885   
* right end position:
+
* inchi key:
** 159366
+
** InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A
* centisome position:
+
* common name:
** 81.3789   
+
** 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
 
* Synonym(s):
 
* Synonym(s):
 +
** 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate
 +
** 1D-myo-inositol 1-diphosphate pentakisphosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CHOLINE-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN-10974]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[ETHANOLAMINE-KINASE-RXN]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-7782]]
+
* [[PWY-7818]]
+
* [[PWY4FS-6]]
+
* [[PWY-3385]]
+
* [[PWY3O-450]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=158308}}
+
* CHEBI:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74945 74945]
{{#set: right end position=159366}}
+
* PUBCHEM:
{{#set: centisome position=81.3789    }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479488 45479488]
{{#set: reaction associated=CHOLINE-KINASE-RXN|ETHANOLAMINE-KINASE-RXN}}
+
{{#set: smiles=C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)}}
{{#set: pathway associated=PWY-7782|PWY-7818|PWY4FS-6|PWY-3385|PWY3O-450}}
+
{{#set: molecular weight=805.885    }}
 +
{{#set: inchi key=InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A}}
 +
{{#set: common name=1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
 +
{{#set: common name=1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate|1D-myo-inositol 1-diphosphate pentakisphosphate}}
 +
{{#set: produced by=RXN-10974}}

Latest revision as of 16:16, 9 January 2019

Metabolite CPD-11938

  • smiles:
    • C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)
  • molecular weight:
    • 805.885
  • inchi key:
    • InChIKey=HHQOOERQSFJGEP-SLWYWOEDSA-A
  • common name:
    • 1D-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
  • Synonym(s):
    • 1,5-bisdiphosphoinositol-1D-myo-inositol (2,3,4,6)tetrakisphosphate
    • 1D-myo-inositol 1-diphosphate pentakisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OP(=O)([O-])[O-])(C(OP(=O)([O-])[O-])C(OP([O-])(=O)OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(OP([O-])(=O)[O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.