Difference between revisions of "13-HYDROPEROXYOCTADECA-911-DIENOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00007380001_1 == * Synonym(s): == Reactions associated == * DIHYDLIPACETRANS-RXN ** pantograph-galdieria.sulphuraria * PYRUVDEH-R...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROPEROXYOCTADECA-911-DIENOATE 13-HYDROPEROXYOCTADECA-911-DIENOATE] == |
| + | * smiles: | ||
| + | ** CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO | ||
| + | * molecular weight: | ||
| + | ** 311.44 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M | ||
| + | * common name: | ||
| + | ** (13S)-HPODE | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate | ||
| + | ** (9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[HYDROHEX-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[LIPOXYGENASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57466 57466] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158461 21158461] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04717 C04717] | ||
| + | * LIPID_MAPS : LMFA01040001 | ||
| + | * HMDB : HMDB03871 | ||
| + | {{#set: smiles=CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO}} | ||
| + | {{#set: molecular weight=311.44 }} | ||
| + | {{#set: inchi key=InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M}} | ||
| + | {{#set: common name=(13S)-HPODE}} | ||
| + | {{#set: common name=13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate|(9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate}} | ||
| + | {{#set: consumed by=HYDROHEX-RXN}} | ||
| + | {{#set: produced by=LIPOXYGENASE-RXN}} | ||
Latest revision as of 15:19, 9 January 2019
Contents
Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE
- smiles:
- CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO
- molecular weight:
- 311.44
- inchi key:
- InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M
- common name:
- (13S)-HPODE
- Synonym(s):
- 13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate
- (9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO" cannot be used as a page name in this wiki.
