Difference between revisions of "RIBOSYN2-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** flavin biosynthesis I (bacteria and plants) |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** riboflavin, FMN and FAD biosynthesis | ||
+ | ** vitamin B2 biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''8''' reactions found over '''9''' reactions in the full pathway |
− | + | * [[DIOHBUTANONEPSYN-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[RXN- | + | *** [[CHC_T00001056001_1]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
− | * [ | + | *** [[orthology-galdieria.sulphuraria]] |
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[FADSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00002523001_1]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[GTP-CYCLOHYDRO-II-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00001056001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[LUMAZINESYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00007345001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIBOFLAVIN-SYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00004285001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIBOFLAVINKIN-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00000009001_1]] | ||
+ | *** [[CHC_T00009043001_1]] | ||
+ | *** [[CHC_T00002338001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIBOFLAVINSYNDEAM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00006214001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | * [[RIBOFLAVINSYNREDUC-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00006214001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] | |
− | + | * ARACYC: | |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] | |
− | ** [http:// | + | {{#set: common name=flavin biosynthesis I (bacteria and plants)}} |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=riboflavin, FMN and FAD biosynthesis|vitamin B2 biosynthesis}} | |
− | * | + | {{#set: reaction found=8}} |
− | ** [http:// | + | {{#set: total reaction=9}} |
− | + | {{#set: completion rate=89.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:19, 9 January 2019
Pathway RIBOSYN2-PWY
- common name:
- flavin biosynthesis I (bacteria and plants)
- taxonomic range:
- Synonym(s):
- riboflavin, FMN and FAD biosynthesis
- vitamin B2 biosynthesis
Reaction(s) found
8 reactions found over 9 reactions in the full pathway
- DIOHBUTANONEPSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- FADSYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GTP-CYCLOHYDRO-II-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- LUMAZINESYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RIBOFLAVIN-SYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RIBOFLAVINKIN-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RIBOFLAVINSYNDEAM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RIBOFLAVINSYNREDUC-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
- ARACYC: