Difference between revisions of "3-SULFINYL-PYRUVATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(S([O-])=O)C(=O)C(=O)[O-] | ** C(S([O-])=O)C(=O)C(=O)[O-] | ||
+ | * molecular weight: | ||
+ | ** 150.106 | ||
* inchi key: | * inchi key: | ||
** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L | ** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
** 3-sulfinopyruvate | ** 3-sulfinopyruvate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** 3-sulphinyl-pyruvate | ** 3-sulphinyl-pyruvate | ||
Line 19: | Line 19: | ||
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665] | ||
Line 26: | Line 24: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05527 C05527] | ||
* HMDB : HMDB02332 | * HMDB : HMDB02332 | ||
{{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}} | {{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}} | ||
+ | {{#set: molecular weight=150.106 }} | ||
{{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}} | {{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}} | ||
{{#set: common name=3-sulfinopyruvate}} | {{#set: common name=3-sulfinopyruvate}} | ||
− | |||
{{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}} | {{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}} | ||
{{#set: reversible reaction associated=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}} | {{#set: reversible reaction associated=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 15:22, 9 January 2019
Contents
Metabolite 3-SULFINYL-PYRUVATE
- smiles:
- C(S([O-])=O)C(=O)C(=O)[O-]
- molecular weight:
- 150.106
- inchi key:
- InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L
- common name:
- 3-sulfinopyruvate
- Synonym(s):
- 3-sulphinyl-pyruvate
- β-sulfinylpyruvate
- 3-sulfinyl-pyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(S([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.