Difference between revisions of "PWY66-378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * common name: ** L-cys...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-378 PWY66-378] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** androgen biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** testosterone biosynthesis | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN66-342]] |
| − | * [ | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00007359001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.64-RXN 1.1.1.64-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-340 RXN66-340] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-341 RXN66-341] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-343 RXN66-343] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-362 RXN66-362] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=androgen biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-7742}} | |
| − | + | {{#set: common name=testosterone biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:36, 9 January 2019
Pathway PWY66-378
- common name:
- androgen biosynthesis
- taxonomic range:
- Synonym(s):
- testosterone biosynthesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN66-342
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
