Difference between revisions of "RXN-11482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* common name:
+
−
** demethylmenaquinol-8
+
−
* molecular weight:
+
−
** 705.118   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-demethylmenaquinol-8
 
−
** DMKH2-8
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Pimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an enoylpimeloyl-[acp] methyl ester[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 a pimeloyl-[acp] methyl ester[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009325001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''7''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277]
+
{{#set: ec number=EC-1.3.1.9}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00009325001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873]
+
{{#set: in pathway=PWY-6519}}
−
* BIGG : 2dmmql8
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
−
{{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=demethylmenaquinol-8}}
+
−
{{#set: molecular weight=705.118    }}
+
−
{{#set: common name=2-demethylmenaquinol-8|DMKH2-8}}
+
−
{{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}}
+

Latest revision as of 15:46, 9 January 2019

Reaction RXN-11482

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 7 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-11482&oldid=20781"