Difference between revisions of "CPD-8614"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008780001 == * left end position: ** 92631 * transcription direction: ** NEGATIVE * right end position: ** 95357 * centisome position: ** 55.5...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008780001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
* left end position:
+
* smiles:
** 92631
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 398.671   
* right end position:
+
* inchi key:
** 95357
+
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
* centisome position:
+
* common name:
** 55.561153   
+
** 4α-methyl-5α-cholesta-8-en-3-one
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.4.1.82-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
* [[RXN66-18]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-6524]]
+
* [[PWY-6525]]
+
* [[PWY-5337]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=92631}}
+
* CHEBI:
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
{{#set: right end position=95357}}
+
* PUBCHEM:
{{#set: centisome position=55.561153    }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
{{#set: reaction associated=2.4.1.82-RXN}}
+
* HMDB : HMDB12174
{{#set: pathway associated=PWY-6524|PWY-6525|PWY-5337}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
 +
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
 +
{{#set: produced by=RXN66-18}}

Latest revision as of 16:51, 9 January 2019

Metabolite CPD-8614

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
  • molecular weight:
    • 398.671
  • inchi key:
    • InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
  • common name:
    • 4α-methyl-5α-cholesta-8-en-3-one
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.