Difference between revisions of "CHC T00000060001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00000060001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | + | * Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | == | + | * Reaction: [[RXN-12195]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | * Reaction: [[RXN-12196]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[RXN0-5462]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7210]] | ||
+ | * [[PWY-7198]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-6545|PWY-7184|PWY-7210|PWY-7198}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 15:55, 9 January 2019
Gene CHC_T00000060001_1
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-12195
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-12196
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN0-5462
- Source: orthology-ectocarpus_siliculosus