Difference between revisions of "CPD-18780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-tRNAMet Elongation-tRNAMet] == * common name: ** elongator tRNAmet * Synonym(s): **...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Elongation-tRNAMet Elongation-tRNAMet] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18780 CPD-18780] ==
 +
* smiles:
 +
** C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
 +
* molecular weight:
 +
** 192.168   
 +
* inchi key:
 +
** InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N
 
* common name:
 
* common name:
** elongator tRNAmet
+
** 2-epi-valiolone
 
* Synonym(s):
 
* Synonym(s):
** a tRNAmet
+
** (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one
** TRNA(MET)
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17373]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=elongator tRNAmet}}
+
{{#set: smiles=C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)}}
{{#set: common name=a tRNAmet|TRNA(MET)}}
+
{{#set: molecular weight=192.168    }}
{{#set: consumed by=METHIONINE--TRNA-LIGASE-RXN}}
+
{{#set: inchi key=InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N}}
 +
{{#set: common name=2-epi-valiolone}}
 +
{{#set: common name=(2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one}}
 +
{{#set: produced by=RXN-17373}}

Latest revision as of 17:13, 9 January 2019

Metabolite CPD-18780

  • smiles:
    • C(O)C1(O)(C(O)C(O)C(O)C(=O)C1)
  • molecular weight:
    • 192.168
  • inchi key:
    • InChIKey=JCZFNXYQGNLHDQ-JWXFUTCRSA-N
  • common name:
    • 2-epi-valiolone
  • Synonym(s):
    • (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-5-(hydroxymethyl)cyclohexan-1-one

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links