Difference between revisions of "PAPS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PAPS PAPS] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(OP(=O)([O-])OS(=O)(=O)[O-])C1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))) |
+ | * molecular weight: | ||
+ | ** 503.23 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GACDQMDRPRGCTN-KQYNXXCUSA-J |
* common name: | * common name: | ||
− | ** | + | ** 3'-phosphoadenylyl-sulfate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phosphoadenosine-5'-phosphosulfate |
+ | ** PAPS | ||
+ | ** phosphoadenosine phosphosulfate | ||
+ | ** 3'-phosphoadenosine-5'-phosphosulfate | ||
+ | ** 3'-phosphoadenylyl sulfate | ||
+ | ** 3'-phospho-5'-adenylyl sulfate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-18301]] |
+ | * [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] | ||
+ | * [[RXN-18303]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ADENYLYLSULFKIN-RXN]] | ||
+ | * [[RXN-17203]] | ||
+ | * [[1.8.4.8-RXN]] | ||
+ | * [[R163-RXN]] | ||
+ | * [[RXN-701]] | ||
== External links == | == External links == | ||
− | * | + | * KNAPSACK : C00007446 |
− | ** [http:// | + | * BIGG : paps |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00053 C00053] | ||
+ | * HMDB : HMDB01134 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58339 58339] |
− | {{#set: smiles= | + | * CAS : 482-67-7 |
− | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926099 46926099] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58339 |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OS(=O)(=O)[O-])C1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23)))}} |
− | {{#set: | + | {{#set: molecular weight=503.23 }} |
+ | {{#set: inchi key=InChIKey=GACDQMDRPRGCTN-KQYNXXCUSA-J}} | ||
+ | {{#set: common name=3'-phosphoadenylyl-sulfate}} | ||
+ | {{#set: common name=phosphoadenosine-5'-phosphosulfate|PAPS|phosphoadenosine phosphosulfate|3'-phosphoadenosine-5'-phosphosulfate|3'-phosphoadenylyl sulfate|3'-phospho-5'-adenylyl sulfate}} | ||
+ | {{#set: consumed by=RXN-18301|GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-18303}} | ||
+ | {{#set: reversible reaction associated=ADENYLYLSULFKIN-RXN|RXN-17203|1.8.4.8-RXN|R163-RXN|RXN-701}} |
Latest revision as of 17:13, 9 January 2019
Contents
Metabolite PAPS
- smiles:
- C(OP(=O)([O-])OS(=O)(=O)[O-])C1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23)))
- molecular weight:
- 503.23
- inchi key:
- InChIKey=GACDQMDRPRGCTN-KQYNXXCUSA-J
- common name:
- 3'-phosphoadenylyl-sulfate
- Synonym(s):
- phosphoadenosine-5'-phosphosulfate
- PAPS
- phosphoadenosine phosphosulfate
- 3'-phosphoadenosine-5'-phosphosulfate
- 3'-phosphoadenylyl sulfate
- 3'-phospho-5'-adenylyl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- KNAPSACK : C00007446
- BIGG : paps
- LIGAND-CPD:
- HMDB : HMDB01134
- CHEBI:
- CAS : 482-67-7
- PUBCHEM:
- METABOLIGHTS : MTBLC58339
"C(OP(=O)([O-])OS(=O)(=O)[O-])C1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23)))" cannot be used as a page name in this wiki.