Difference between revisions of "RXN3O-218"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] == * smiles: ** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** 9-cis-β-carotene
+
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
−
* inchi key:
+
−
** InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N
+
−
* molecular weight:
+
−
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[EPISTEROL]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-700]][c] '''+''' 2 [[WATER]][c]
−
* [[RXN-13641]]
+
* With common name(s):
 +
** 2 H+[c] '''+''' 1 oxygen[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 episterol[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 ergosta-5,7,24(28)-trien-3β-ol[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00006481001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''12''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C20484 C20484]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33463 33463]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67188 67188]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07505 R07505]
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07491 R07491]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9828626 9828626]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: smiles=CC(C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1))=CC=CC=C(C=CC=C(C=CC2(=C(CCCC2(C)C)C))C)C}}
+
{{#set: ec number=EC-1.14.19.20}}
−
{{#set: common name=9-cis-β-carotene}}
+
{{#set: gene associated=CHC_T00006481001_1}}
−
{{#set: inchi key=InChIKey=OENHQHLEOONYIE-BVZAMQQESA-N}}
+
{{#set: in pathway=PWY-6075|PWY-2541}}
−
{{#set: molecular weight=536.882    }}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed or produced by=RXN-13641}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 16:17, 9 January 2019

Reaction RXN3O-218

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6075, ergosterol biosynthesis I: PWY-6075
    • 2 reactions found over 5 reactions in the full pathway
  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 12 reactions found over 36 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN3O-218&oldid=21528"