Difference between revisions of "CHC T00008312001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Gene CHC_T00008312001 ==
−
* smiles:
+
* left end position:
−
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
** 98028
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** cobalt-precorrin-2
+
** 101072
−
* molecular weight:
+
* centisome position:
−
** 912.701    
+
** 81.13289    
 
* Synonym(s):
 
* Synonym(s):
−
** cobalt-dihydrosirohydrochlorin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2OXOGLUTARATEDEH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN-8759]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[2OXOGLUTDECARB-RXN]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7716]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN0-1147]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[TCA]]
 +
* [[PWY-5084]]
 +
* [[PWY66-398]]
 +
* [[PWY-5690]]
 +
* [[PWY-7254]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=98028}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=101072}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: centisome position=81.13289   }}
−
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: reaction associated=2OXOGLUTARATEDEH-RXN|2OXOGLUTDECARB-RXN|RXN-7716|RXN0-1147}}
−
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: pathway associated=TCA|PWY-5084|PWY66-398|PWY-5690|PWY-7254}}
−
{{#set: common name=cobalt-precorrin-2}}
+
−
{{#set: molecular weight=912.701   }}
+
−
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
−
{{#set: consumed or produced by=RXN-8759}}
+

Latest revision as of 16:21, 9 January 2019

Gene CHC_T00008312001

  • left end position:
    • 98028
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 101072
  • centisome position:
    • 81.13289
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008312001&oldid=21632"