Difference between revisions of "CPD-18773"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18773 CPD-18773] == |
* smiles: | * smiles: | ||
− | ** C1( | + | ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) |
+ | * molecular weight: | ||
+ | ** 174.153 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N |
* common name: | * common name: | ||
− | ** | + | ** (R)-demethyl-4-deoxygadusol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17366]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17372]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-17895]] |
== External links == | == External links == | ||
− | + | {{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}} | |
− | + | {{#set: molecular weight=174.153 }} | |
− | + | {{#set: inchi key=InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N}} | |
− | + | {{#set: common name=(R)-demethyl-4-deoxygadusol}} | |
− | + | {{#set: common name=(5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}} | |
− | + | {{#set: consumed by=RXN-17366}} | |
− | + | {{#set: produced by=RXN-17372}} | |
− | + | {{#set: reversible reaction associated=RXN-17895}} | |
− | + | ||
− | + | ||
− | {{#set: smiles=C1( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by=RXN- | + | |
− | {{#set: produced by= | + | |
− | {{#set: | + |
Latest revision as of 17:27, 9 January 2019
Contents
Metabolite CPD-18773
- smiles:
- C(O)C1(O)(CC(=O)C(O)=C(O)C1)
- molecular weight:
- 174.153
- inchi key:
- InChIKey=OWHGXOODGNBQRG-SSDOTTSWSA-N
- common name:
- (R)-demethyl-4-deoxygadusol
- Synonym(s):
- (5R)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one