Difference between revisions of "CPD-13694"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008864001 == * left end position: ** 55864 * transcription direction: ** NEGATIVE * right end position: ** 57045 * centisome position: ** 19.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008864001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13694 CPD-13694] ==
* left end position:
+
* smiles:
** 55864
+
** CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 1176.114   
* right end position:
+
* inchi key:
** 57045
+
** InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J
* centisome position:
+
* common name:
** 19.369446   
+
** 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** cholest-4-en-24-ol-3-one-26-oyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ADPREDUCT-RXN]]
+
* [[RXN-12705]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[CDPREDUCT-RXN]]
+
** original_genome
+
***automated-name-match
+
* [[GDPREDUCT-RXN]]
+
** original_genome
+
***automated-name-match
+
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
+
** original_genome
+
***automated-name-match
+
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+
** original_genome
+
***automated-name-match
+
* [[RXN0-722]]
+
** original_genome
+
***automated-name-match
+
* [[RXN0-747]]
+
** original_genome
+
***automated-name-match
+
* [[RXN0-748]]
+
** original_genome
+
***automated-name-match
+
* [[UDPREDUCT-RXN]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-7210]]
+
* [[PWY-7198]]
+
* [[PWY-7220]]
+
* [[PWY-7184]]
+
* [[PWY-7222]]
+
* [[PWY0-166]]
+
* [[PWY-7227]]
+
* [[PWY-7226]]
+
* [[PWY-6545]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=55864}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658714 90658714]
{{#set: right end position=57045}}
+
{{#set: smiles=CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
{{#set: centisome position=19.369446    }}
+
{{#set: molecular weight=1176.114    }}
{{#set: reaction associated=ADPREDUCT-RXN|CDPREDUCT-RXN|GDPREDUCT-RXN|RIBONUCLEOSIDE-DIP-REDUCTI-RXN|RIBONUCLEOSIDE-DIP-REDUCTII-RXN|RXN0-722|RXN0-747|RXN0-748|UDPREDUCT-RXN}}
+
{{#set: inchi key=InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J}}
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7220|PWY-7184|PWY-7222|PWY0-166|PWY-7227|PWY-7226|PWY-6545}}
+
{{#set: common name=24-hydroxy-3-oxocholest-4-en-26-oyl-CoA}}
 +
{{#set: common name=cholest-4-en-24-ol-3-one-26-oyl-CoA}}
 +
{{#set: consumed by=RXN-12705}}

Latest revision as of 17:28, 9 January 2019

Metabolite CPD-13694

  • smiles:
    • CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
  • molecular weight:
    • 1176.114
  • inchi key:
    • InChIKey=LPAPCIXIEIQRQA-OQRFGCRRSA-J
  • common name:
    • 24-hydroxy-3-oxocholest-4-en-26-oyl-CoA
  • Synonym(s):
    • cholest-4-en-24-ol-3-one-26-oyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC(O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))" cannot be used as a page name in this wiki.