Difference between revisions of "ARGININE-SYN4-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ARGININE-SYN4-PWY ARGININE-SYN4-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-ornithine biosynthesis II |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''4''' reactions found over '''4''' reactions in the full pathway |
| − | + | * [[GLUTAMATE-DEHYDROGENASE-NADP+-RXN]] | |
| − | * [[ | + | ** 2 associated gene(s): |
| − | + | *** [[CHC_T00010235001_1]] | |
| − | * [[ | + | *** [[CHC_T00010235001]] |
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | * [[GLUTKIN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00008349001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008349001_1]] | ||
| + | *** [[CHC_T00008349001]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00002893001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=L-ornithine biosynthesis II}} | |
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 16:29, 9 January 2019
Pathway ARGININE-SYN4-PWY
- common name:
- L-ornithine biosynthesis II
- taxonomic range:
- Synonym(s):
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- GLUTAMATE-DEHYDROGENASE-NADP+-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTSEMIALDEHYDROG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
