Difference between revisions of "RXN-4209"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15590 CPD-15590] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4209 RXN-4209] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-4125]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[CPD-4126]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 oxygen[c] '''+''' 1 avenasterol[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 5-dehydroavenasterol[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00006481001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] | ||
| + | ** '''12''' reactions found over '''36''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * LIGAND-RXN: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07486 R07486] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.14.19.20}} | |
| − | + | {{#set: gene associated=CHC_T00006481001_1}} | |
| − | + | {{#set: in pathway=PWY-2541}} | |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:42, 9 January 2019
Contents
Reaction RXN-4209
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-4125[c] + 2 PROTON[c] + 2 FERROCYTOCHROME-B5[c] => 2 FERRICYTOCHROME-B5[c] + 2 WATER[c] + 1 CPD-4126[c]
- With common name(s):
- 1 oxygen[c] + 1 avenasterol[c] + 2 H+[c] + 2 a ferrocytochrome b5[c] => 2 a ferricytochrome b5[c] + 2 H2O[c] + 1 5-dehydroavenasterol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006481001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY-2541, plant sterol biosynthesis: PWY-2541
- 12 reactions found over 36 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- LIGAND-RXN:
