Difference between revisions of "CHC T00009254001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] ==
+
== Gene CHC_T00009254001 ==
* smiles:
+
* left end position:
** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 135178
* inchi key:
+
* transcription direction:
** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
+
** POSITIVE
* common name:
+
* right end position:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
+
** 136614
* molecular weight:
+
* centisome position:
** 1037.905    
+
** 25.841465    
 
* Synonym(s):
 
* Synonym(s):
** OPC8-trans-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10697]]
+
* Reaction: [[GLYCPDIESTER-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
* [[RXN-10696]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14073]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14136]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14160]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6952]]
 +
* [[PWY-7409]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=135178}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=136614}}
{{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}}
+
{{#set: centisome position=25.841465   }}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}}
+
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
{{#set: molecular weight=1037.905   }}
+
{{#set: pathway associated=PWY-6952|PWY-7409}}
{{#set: common name=OPC8-trans-2-enoyl-CoA}}
+
{{#set: consumed by=RXN-10697}}
+
{{#set: produced by=RXN-10696}}
+

Latest revision as of 17:48, 9 January 2019

Gene CHC_T00009254001

  • left end position:
    • 135178
  • transcription direction:
    • POSITIVE
  • right end position:
    • 136614
  • centisome position:
    • 25.841465
  • Synonym(s):

Reactions associated

Pathways associated

External links