Difference between revisions of "CPD-18778"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18778 CPD-18778] == * smiles: ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1) * comm...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1) | ** COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 330.294 | ** 330.294 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L | ||
| + | * common name: | ||
| + | ** shinorine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 18: | Line 18: | ||
== External links == | == External links == | ||
{{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)}} | {{#set: smiles=COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=330.294 }} | {{#set: molecular weight=330.294 }} | ||
| + | {{#set: inchi key=InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L}} | ||
| + | {{#set: common name=shinorine}} | ||
{{#set: consumed by=extended_PHOSPHASERDECARB-RXN_CPD-18778}} | {{#set: consumed by=extended_PHOSPHASERDECARB-RXN_CPD-18778}} | ||
{{#set: reversible reaction associated=RXN-17371}} | {{#set: reversible reaction associated=RXN-17371}} | ||
Latest revision as of 17:35, 9 January 2019
Contents
Metabolite CPD-18778
- smiles:
- COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)
- molecular weight:
- 330.294
- inchi key:
- InChIKey=WXEQFJUHQIGKNG-MZNRBSSJSA-L
- common name:
- shinorine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(=C(NCC([O-])=O)CC(CO)(O)CC(=NC(C([O-])=O)CO)1)" cannot be used as a page name in this wiki.
