Difference between revisions of "CPD-9894"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008666001 == * left end position: ** 102279 * transcription direction: ** POSITIVE * right end position: ** 103822 * centisome position: ** 14...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9894 CPD-9894] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C |
| − | * | + | * molecular weight: |
| − | ** | + | ** 698.06 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZTGCMYPRIIAXFD-LHSBZCSKSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-(3,7,11,15,19,23-octamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid | ||
| + | ** 3-octaprenyl-4,5-dihydroxybenzoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9280]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84452 84452] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740337 54740337] |
| − | {{#set: | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C}} |
| + | {{#set: molecular weight=698.06 }} | ||
| + | {{#set: inchi key=InChIKey=ZTGCMYPRIIAXFD-LHSBZCSKSA-M}} | ||
| + | {{#set: common name=3,4-dihydroxy-5-all-trans-octaprenylbenzoate}} | ||
| + | {{#set: common name=3-(3,7,11,15,19,23-octamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-octaprenyl-4,5-dihydroxybenzoate}} | ||
| + | {{#set: consumed by=RXN-9280}} | ||
Latest revision as of 18:45, 9 January 2019
Contents
Metabolite CPD-9894
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C
- molecular weight:
- 698.06
- inchi key:
- InChIKey=ZTGCMYPRIIAXFD-LHSBZCSKSA-M
- common name:
- 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
- Synonym(s):
- 3-(3,7,11,15,19,23-octamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
- 3-octaprenyl-4,5-dihydroxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
