Difference between revisions of "CHC T00008772001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-313 CPD-313] == * smiles: ** C(CC[N+])[N+] * inchi key: ** InChIKey=XFNJVJPLKCPIBV-UHFFFAOY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * smiles: ** CC(C)(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=JTEYKUFKXGD...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC(C)(O)C(O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M |
* common name: | * common name: | ||
− | ** | + | ** (2R)-2,3-dihydroxy-3-methylbutanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 133.124 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (R)-2,3-dihydroxy-3-methylbutanoate |
− | + | ** (R)-2,3-dihydroxy-isovalerate | |
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DIHYDROXYISOVALDEHYDRAT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ACETOLACTREDUCTOISOM-RXN]] |
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04272 C04272] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.19951355.html 19951355] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49072 49072] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles=C( | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615351 23615351] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB12141 |
− | {{#set: common name= | + | {{#set: smiles=CC(C)(O)C(O)C(=O)[O-]}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M}} |
− | {{#set: common name= | + | {{#set: common name=(2R)-2,3-dihydroxy-3-methylbutanoate}} |
− | {{#set: | + | {{#set: molecular weight=133.124 }} |
− | {{#set: consumed or produced by= | + | {{#set: common name=(R)-2,3-dihydroxy-3-methylbutanoate|(R)-2,3-dihydroxy-isovalerate}} |
+ | {{#set: consumed by=DIHYDROXYISOVALDEHYDRAT-RXN}} | ||
+ | {{#set: consumed or produced by=ACETOLACTREDUCTOISOM-RXN}} |
Revision as of 11:57, 18 January 2018
Contents
Metabolite CPD-13357
- smiles:
- CC(C)(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=JTEYKUFKXGDTEU-VKHMYHEASA-M
- common name:
- (2R)-2,3-dihydroxy-3-methylbutanoate
- molecular weight:
- 133.124
- Synonym(s):
- (R)-2,3-dihydroxy-3-methylbutanoate
- (R)-2,3-dihydroxy-isovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.