Difference between revisions of "CHC T00002063001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-R-S-oxides Protein-L-methionine-R-S-oxides] == * common name: ** a protein...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-R-S-oxides Protein-L-methionine-R-S-oxides] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
 
* common name:
 
* common name:
** a protein-L-methionine-(R)-S-oxide
+
** 4α-methyl-5α-cholesta-8-en-3-one
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
** a peptide-L-methionine-(R)-S-oxide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-18]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[1.8.4.12-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a protein-L-methionine-(R)-S-oxide}}
+
* PUBCHEM:
{{#set: common name=a peptide-L-methionine-(R)-S-oxide}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
{{#set: consumed or produced by=1.8.4.12-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
 +
* HMDB : HMDB12174
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
 +
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
 +
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: produced by=RXN66-18}}

Revision as of 12:03, 18 January 2018

Metabolite CPD-8614

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
  • common name:
    • 4α-methyl-5α-cholesta-8-en-3-one
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.