Difference between revisions of "PWY-699"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16761 RXN-16761] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7229 CPD-7229] == * smiles: ** C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O * common name: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7229 CPD-7229] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O |
| − | * | + | * common name: |
| − | ** | + | ** 1-(β-D-ribofuranosyl)-1,4-dihydronicotinamide |
| + | * inchi key: | ||
| + | ** InChIKey=MAKBMGXNXXXBFE-TURQNECASA-N | ||
| + | * molecular weight: | ||
| + | ** 256.258 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11507134 11507134] | |
| − | {{#set: | + | * HMDB : HMDB11648 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55458 55458] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15497 C15497] |
| + | {{#set: smiles=C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O}} | ||
| + | {{#set: common name=1-(β-D-ribofuranosyl)-1,4-dihydronicotinamide}} | ||
| + | {{#set: inchi key=InChIKey=MAKBMGXNXXXBFE-TURQNECASA-N}} | ||
| + | {{#set: molecular weight=256.258 }} | ||
| + | {{#set: consumed or produced by=1.10.99.2-RXN-CPD-7229/PLASTOQUINONE-9/PROTON//CPD-12829/NICOTINAMIDE_RIBOSE.63.}} | ||
Revision as of 11:04, 18 January 2018
Contents
Metabolite CPD-7229
- smiles:
- C(C2(OC(N1(C=C(CC=C1)C(=O)N))C(C(O)2)O))O
- common name:
- 1-(β-D-ribofuranosyl)-1,4-dihydronicotinamide
- inchi key:
- InChIKey=MAKBMGXNXXXBFE-TURQNECASA-N
- molecular weight:
- 256.258
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
