Difference between revisions of "PWY-5076"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN] == * direction:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** aspartate-semialdehyde dehydrogenase (AsA dehydrogenase) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.11 EC-1.2.1.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Pi]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[L-ASPARTATE-SEMIALDEHYDE]][c] '''<=>''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[L-BETA-ASPARTYL-P]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 phosphate[c] '''+''' 1 NADP+[c] '''+''' 1 L-aspartate-semialdehyde[c] '''<=>''' 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 L-aspartyl-4-phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009423001]] | ||
+ | ** ORIGINAL_GENOME | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | * [[CHC_T00009423001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | == Pathways == | ||
+ | * [[HOMOSERSYN-PWY]], L-homoserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERSYN-PWY HOMOSERSYN-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7153]], grixazone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7153 PWY-7153] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-6559]], spermidine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6559 PWY-6559] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6562]], norspermidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6562 PWY-6562] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[P101-PWY]], ectoine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=P101-PWY P101-PWY] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
+ | *** [[a.taliana]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[original_genome]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * RHEA: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24284 24284] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02291 R02291] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P10539 P10539] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P41394 P41394] |
− | * | + | ** [http://www.uniprot.org/uniprot/P44801 P44801] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O67716 O67716] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q59291 Q59291] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P57008 P57008] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A9Q9 P0A9Q9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O25801 O25801] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q57658 Q57658] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q04797 Q04797] |
+ | ** [http://www.uniprot.org/uniprot/Q56732 Q56732] | ||
+ | ** [http://www.uniprot.org/uniprot/Q56734 Q56734] | ||
+ | ** [http://www.uniprot.org/uniprot/P13663 P13663] | ||
+ | ** [http://www.uniprot.org/uniprot/P23247 P23247] | ||
+ | ** [http://www.uniprot.org/uniprot/P41399 P41399] | ||
+ | ** [http://www.uniprot.org/uniprot/P41404 P41404] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JN40 Q9JN40] | ||
+ | ** [http://www.uniprot.org/uniprot/P26511 P26511] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55512 Q55512] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=aspartate-semialdehyde dehydrogenase (AsA dehydrogenase)}} | ||
+ | {{#set: ec number=EC-1.2.1.11}} | ||
+ | {{#set: gene associated=CHC_T00009423001|CHC_T00009423001_1}} | ||
+ | {{#set: in pathway=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-6562|PWY-5097|P101-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} | ||
+ | {{#set: reconstruction source=original_genome}} |
Revision as of 12:09, 18 January 2018
Contents
Reaction ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN
- direction:
- REVERSIBLE
- common name:
- aspartate-semialdehyde dehydrogenase (AsA dehydrogenase)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Pi[c] + 1 NADP[c] + 1 L-ASPARTATE-SEMIALDEHYDE[c] <=> 1 NADPH[c] + 1 PROTON[c] + 1 L-BETA-ASPARTYL-P[c]
- With common name(s):
- 1 phosphate[c] + 1 NADP+[c] + 1 L-aspartate-semialdehyde[c] <=> 1 NADPH[c] + 1 H+[c] + 1 L-aspartyl-4-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- CHC_T00009423001
- ORIGINAL_GENOME
- AUTOMATED-NAME-MATCH
- ORIGINAL_GENOME
- CHC_T00009423001_1
Pathways
- HOMOSERSYN-PWY, L-homoserine biosynthesis: HOMOSERSYN-PWY
- 3 reactions found over 3 reactions in the full pathway
- PWY-7153, grixazone biosynthesis: PWY-7153
- 2 reactions found over 8 reactions in the full pathway
- DAPLYSINESYN-PWY, L-lysine biosynthesis I: DAPLYSINESYN-PWY
- 6 reactions found over 9 reactions in the full pathway
- PWY-2942, L-lysine biosynthesis III: PWY-2942
- 5 reactions found over 7 reactions in the full pathway
- PWY-2941, L-lysine biosynthesis II: PWY-2941
- 6 reactions found over 9 reactions in the full pathway
- PWY-6559, spermidine biosynthesis II: PWY-6559
- 2 reactions found over 4 reactions in the full pathway
- PWY-6562, norspermidine biosynthesis: PWY-6562
- 2 reactions found over 6 reactions in the full pathway
- PWY-5097, L-lysine biosynthesis VI: PWY-5097
- 7 reactions found over 7 reactions in the full pathway
- P101-PWY, ectoine biosynthesis: P101-PWY
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: