Difference between revisions of "DIPHTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-332 CPD-332] == * smiles: ** CC(CO)CCNC2(=NC=NC1(=C(N=CN1)2)) * inchi key: ** InChIKey=XXFA...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11811 RXN-11811] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11811 RXN-11811] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[AMMONIA]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[AMMONIUM]][c] | |
| − | == | + | * With common name(s): |
| + | ** 1 ammonia[c] '''+''' 1 H+[c] '''<=>''' 1 ammonium[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[original_genome]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=original_genome}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 11:14, 18 January 2018
Contents
Reaction RXN-11811
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ammonia[c] + 1 H+[c] <=> 1 ammonium[c]
