Difference between revisions of "3-oxo-cerotoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pullulans Pullulans] == * common name: ** pullulan * Synonym(s): == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pullulans Pullulans] ==
* smiles:
+
** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
+
* inchi key:
+
** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
+
 
* common name:
 
* common name:
** dehydroascorbate (bicyclic form)
+
** pullulan
* molecular weight:
+
** 192.125   
+
 
* Synonym(s):
 
* Synonym(s):
** dehydroascorbate monohydrate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12861]]
+
* [[RXN-12302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12862]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=pullulan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
+
{{#set: consumed by=RXN-12302}}
{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
+
{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
+
{{#set: common name=dehydroascorbate (bicyclic form)}}
+
{{#set: molecular weight=192.125    }}
+
{{#set: common name=dehydroascorbate monohydrate}}
+
{{#set: consumed by=RXN-12861}}
+
{{#set: produced by=RXN-12862}}
+

Revision as of 11:20, 18 January 2018

Metabolite Pullulans

  • common name:
    • pullulan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links