Difference between revisions of "KYNURENINE-3-MONOOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * smiles: ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] * inchi...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KYNURENINE-3-MONOOXYGENASE-RXN KYNURENINE-3-MONOOXYGENASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.13.9 EC-1.14.13.9] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[3 | + | * With identifiers: |
− | == | + | ** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-14736]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-HYDROXY-L-KYNURENINE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 oxygen[c] '''+''' 1 L-kynurenine[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 3-hydroxy-L-kynurenine[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00006269001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00004849001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5651]], L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] | ||
+ | ** '''7''' reactions found over '''17''' reactions in the full pathway | ||
+ | * [[PWY-7765]], 3-hydroxy-4-methyl-anthranilate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7765 PWY-7765] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-7717]], 3-hydroxy-4-methyl-anthranilate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7717 PWY-7717] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20545 20545] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01960 R01960] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: ec number=EC-1.14.13.9}} | |
− | + | {{#set: gene associated=CHC_T00006269001_1|CHC_T00004849001_1}} | |
− | + | {{#set: in pathway=PWY-5651|PWY-6309|PWY-7765|PWY-7717}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 18:39, 9 January 2019
Contents
Reaction KYNURENINE-3-MONOOXYGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OXYGEN-MOLECULE[c] + 1 CPD-14736[c] + 1 NADPH[c] + 1 PROTON[c] => 1 3-HYDROXY-L-KYNURENINE[c] + 1 WATER[c] + 1 NADP[c]
- With common name(s):
- 1 oxygen[c] + 1 L-kynurenine[c] + 1 NADPH[c] + 1 H+[c] => 1 3-hydroxy-L-kynurenine[c] + 1 H2O[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006269001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00004849001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-5651, L-tryptophan degradation to 2-amino-3-carboxymuconate semialdehyde: PWY-5651
- 4 reactions found over 5 reactions in the full pathway
- PWY-6309, L-tryptophan degradation XI (mammalian, via kynurenine): PWY-6309
- 7 reactions found over 17 reactions in the full pathway
- PWY-7765, 3-hydroxy-4-methyl-anthranilate biosynthesis II: PWY-7765
- 2 reactions found over 5 reactions in the full pathway
- PWY-7717, 3-hydroxy-4-methyl-anthranilate biosynthesis I: PWY-7717
- 2 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links