Difference between revisions of "Serine-threonine dehydration ASTERINA-330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=Serine-threonine_dehydration_ASTERINA-330 Serine-threonine_dehydration_ASTERINA-330] == * direction...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=Serine-threonine_dehydration_ASTERINA-330 Serine-threonine_dehydration_ASTERINA-330] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[ASTERINA-330]][c] '''=>''' 1.0 [[WATER]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[MAA1]][c] |
− | == | + | * With common name(s): |
+ | ** | ||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009480001]] | ||
+ | ** Source: [[manual-pathmodel_inference_new_rxn]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-pathmodel_inference_new_rxn]] | ||
+ | *** Comment: [[carreto2011;ab initio]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: gene associated=CHC_T00009480001}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-pathmodel_inference_new_rxn}} | |
− | + | {{#set: reconstruction comment=carreto2011;ab initio}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 18:02, 23 May 2018
Contents
Reaction Serine-threonine_dehydration_ASTERINA-330
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 ASTERINA-330[c] => 1.0 WATER[c] + 1.0 PROTON[c] + 1.0 MAA1[c]
- With common name(s):
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009480001
Pathways
Reconstruction information
- Category: manual
- Source: manual-pathmodel_inference_new_rxn
- Comment: carreto2011;ab initio
- Source: manual-pathmodel_inference_new_rxn