Difference between revisions of "DARABITOLUTIL-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=DARABITOLUTIL-PWY DARABITOLUTIL-PWY] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
* inchi key:
+
** InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J
+
 
* common name:
 
* common name:
** 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA
+
** D-arabitol degradation
* molecular weight:
+
* taxonomic range:
** 927.663   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* Synonym(s):
 
* Synonym(s):
** 3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA
+
** D-arabitol utilization
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11245]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[XYLULOKIN-RXN]]
* [[RXN-11244]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00009225001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=D-ARABINITOL-4-DEHYDROGENASE-RXN D-ARABINITOL-4-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=D-arabitol degradation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173446 46173446]
+
{{#set: taxonomic range=TAX-1224}}
* CHEBI:
+
{{#set: common name=D-arabitol utilization}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73549 73549]
+
{{#set: reaction found=1}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=C(O)C=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: total reaction=2}}
{{#set: inchi key=InChIKey=VDDFXUMTXCQMFM-UGDQNKSBSA-J}}
+
{{#set: completion rate=50.0}}
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA}}
+
{{#set: molecular weight=927.663    }}
+
{{#set: common name=3S-(4-hydroxyphenyl)-3-hydroxy-propionyl-CoA}}
+
{{#set: consumed by=RXN-11245}}
+
{{#set: produced by=RXN-11244}}
+

Latest revision as of 16:36, 9 January 2019

Pathway DARABITOLUTIL-PWY

  • common name:
    • D-arabitol degradation
  • taxonomic range:
  • Synonym(s):
    • D-arabitol utilization

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links