Difference between revisions of "PWY-401"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** galactolipid biosynthesis I |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** galactosylglyceride biosynthesis I |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''5''' reactions in the full pathway | |
| − | * [[4.1. | + | * [[2.4.1.46-RXN]] |
| − | * [[ | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[CHC_T00008619001_1]] |
| + | *** [[CHC_T00008381001_1]] | ||
| + | *** [[CHC_T00008753001_1]] | ||
| + | *** [[CHC_T00009002001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-1225]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00008344001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1226 RXN-1226] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16635 RXN-16635] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9721 RXN-9721] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-401 PWY-401] |
| − | + | {{#set: common name=galactolipid biosynthesis I}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=galactosylglyceride biosynthesis I}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:01, 9 January 2019
Pathway PWY-401
- common name:
- galactolipid biosynthesis I
- taxonomic range:
- Synonym(s):
- galactosylglyceride biosynthesis I
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- 2.4.1.46-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-1225
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
