Difference between revisions of "3-oxo-cerotoyl-ACPs"

Latest revision as of 15:48, 23 May 2018

"a 3-oxo-cerotoyl-[acp" cannot be used as a page name in this wiki.

"a 3-oxo-cerotoyl [acyl-carrier-protein" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cerotoyl-ACPs 3-oxo-cerotoyl-ACPs] ==
-* smiles:
-** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
-* inchi key:
-** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
 * common name:
-** dehydroascorbate (bicyclic form)
+** a 3-oxo-cerotoyl-[acp]
-* molecular weight:
-** 192.125
 * Synonym(s):
-** dehydroascorbate monohydrate
+** a 3-oxo-cerotoyl [acyl-carrier-protein]
 == Reaction(s) known to consume the compound ==
-* [[RXN-12861]]
+* [[RXN-10060]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-12862]]
+* [[RXN-10059]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a 3-oxo-cerotoyl-[acp]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
+{{#set: common name=a 3-oxo-cerotoyl [acyl-carrier-protein]}}
-{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
+{{#set: consumed by=RXN-10060}}
-{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
+{{#set: produced by=RXN-10059}}
-{{#set: common name=dehydroascorbate (bicyclic form)}}
-{{#set: molecular weight=192.125    }}
-{{#set: common name=dehydroascorbate monohydrate}}
-{{#set: consumed by=RXN-12861}}
-{{#set: produced by=RXN-12862}}